C19H28N2O3 — CID 154612112
N,N-dimethyl-3-[3-methyl-2,5-dioxo-4-(2-phenylpropyl)pyrrolidin-1-yl]propan-1-amine oxide (PubChem CID 154612112) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is N,N-dimethyl-3-[3-methyl-2,5-dioxo-4-(2-phenylpropyl)pyrrolidin-1-yl]propan-1-amine oxide.
| Compound Name | N,N-dimethyl-3-[3-methyl-2,5-dioxo-4-(2-phenylpropyl)pyrrolidin-1-yl]propan-1-amine oxide |
|---|---|
| PubChem CID | 154612112 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N,N-dimethyl-3-[3-methyl-2,5-dioxo-4-(2-phenylpropyl)pyrrolidin-1-yl]propan-1-amine oxide |
| SMILES | CC(CC1C(=O)N(CCC[N+](C)(C)[O-])C(=O)C1C)c1ccccc1 |
| InChI | InChI=1S/C19H28N2O3/c1-14(16-9-6-5-7-10-16)13-17-15(2)18(22)20(19(17)23)11-8-12-21(3,4)24/h5-7,9-10,14-15,17H,8,11-13H2,1-4H3 |
| InChIKey | UIGGYRQKSBXQSH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|