C25H31NO2 — CID 118410529
1-butyl-3-(1,3-diphenylbutyl)-4-methylpyrrolidine-2,5-dione (PubChem CID 118410529) has the molecular formula C25H31NO2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-butyl-3-(1,3-diphenylbutyl)-4-methylpyrrolidine-2,5-dione.
| Compound Name | 1-butyl-3-(1,3-diphenylbutyl)-4-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 118410529 |
| Molecular Formula | C25H31NO2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | 1-butyl-3-(1,3-diphenylbutyl)-4-methylpyrrolidine-2,5-dione |
| SMILES | CCCCN1C(=O)C(C)C(C(CC(C)c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C25H31NO2/c1-4-5-16-26-24(27)19(3)23(25(26)28)22(21-14-10-7-11-15-21)17-18(2)20-12-8-6-9-13-20/h6-15,18-19,22-23H,4-5,16-17H2,1-3H3 |
| InChIKey | PXTBGIXAKXNVFK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|