C22H25NO2 — CID 58821955
1-hexyl-3,4-diphenylpyrrolidine-2,5-dione (PubChem CID 58821955) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-hexyl-3,4-diphenylpyrrolidine-2,5-dione.
| Compound Name | 1-hexyl-3,4-diphenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58821955 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 1-hexyl-3,4-diphenylpyrrolidine-2,5-dione |
| SMILES | CCCCCCN1C(=O)C(c2ccccc2)C(c2ccccc2)C1=O |
| InChI | InChI=1S/C22H25NO2/c1-2-3-4-11-16-23-21(24)19(17-12-7-5-8-13-17)20(22(23)25)18-14-9-6-10-15-18/h5-10,12-15,19-20H,2-4,11,16H2,1H3 |
| InChIKey | DFAWEGPSRORZDD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|