C24H21NO2 — CID 102100803
3,4-diphenyl-1-(2-phenylethyl)pyrrolidine-2,5-dione (PubChem CID 102100803) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 3,4-diphenyl-1-(2-phenylethyl)pyrrolidine-2,5-dione.
| Compound Name | 3,4-diphenyl-1-(2-phenylethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 102100803 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 3,4-diphenyl-1-(2-phenylethyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C(c2ccccc2)C(c2ccccc2)C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C24H21NO2/c26-23-21(19-12-6-2-7-13-19)22(20-14-8-3-9-15-20)24(27)25(23)17-16-18-10-4-1-5-11-18/h1-15,21-22H,16-17H2 |
| InChIKey | FIOLRWNJLDEPFB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|