C22H25ClN2O2 — CID 57328011
(4R,9aR)-4-phenyl-2-(2-phenylethyl)-4,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,3-dione;hydrochloride (PubChem CID 57328011) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is (4R,9aR)-4-phenyl-2-(2-phenylethyl)-4,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,3-dione;hydrochloride.
| Compound Name | (4R,9aR)-4-phenyl-2-(2-phenylethyl)-4,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 57328011 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (4R,9aR)-4-phenyl-2-(2-phenylethyl)-4,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1[C@H]2CCCCN2[C@H](c2ccccc2)C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C22H24N2O2.ClH/c25-21-19-13-7-8-15-23(19)20(18-11-5-2-6-12-18)22(26)24(21)16-14-17-9-3-1-4-10-17;/h1-6,9-12,19-20H,7-8,13-16H2;1H/t19-,20-;/m1./s1 |
| InChIKey | CAATXFBVTLNPOW-GZJHNZOKSA-N |
| XLogP | 3.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|