C24H26N2O3 — CID 55733318
1-benzyl-3-(2-cyclohexyl-2-oxoethyl)-5-phenylimidazolidine-2,4-dione (PubChem CID 55733318) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-benzyl-3-(2-cyclohexyl-2-oxoethyl)-5-phenylimidazolidine-2,4-dione.
| Compound Name | 1-benzyl-3-(2-cyclohexyl-2-oxoethyl)-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55733318 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-benzyl-3-(2-cyclohexyl-2-oxoethyl)-5-phenylimidazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)C(c2ccccc2)N(Cc2ccccc2)C1=O)C1CCCCC1 |
| InChI | InChI=1S/C24H26N2O3/c27-21(19-12-6-2-7-13-19)17-26-23(28)22(20-14-8-3-9-15-20)25(24(26)29)16-18-10-4-1-5-11-18/h1,3-5,8-11,14-15,19,22H,2,6-7,12-13,16-17H2 |
| InChIKey | CBXFIXSVWZYYJO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|