C30H25N3O3 — CID 55622382
4-[(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]-N-phenylbenzamide (PubChem CID 55622382) has the molecular formula C30H25N3O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is 4-[(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]-N-phenylbenzamide.
| Compound Name | 4-[(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 55622382 |
| Molecular Formula | C30H25N3O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 4-[(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(CN2C(=O)C(c3ccccc3)N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C30H25N3O3/c34-28(31-26-14-8-3-9-15-26)25-18-16-23(17-19-25)21-33-29(35)27(24-12-6-2-7-13-24)32(30(33)36)20-22-10-4-1-5-11-22/h1-19,27H,20-21H2,(H,31,34) |
| InChIKey | OANMFSCPWUKDCP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|