C28H28N4O3 — CID 55622157
2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 55622157) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55622157 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)C(c2ccccc2)N(Cc2ccccc2)C1=O)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C28H28N4O3/c33-25(29-23-13-15-24(16-14-23)30-17-7-8-18-30)20-32-27(34)26(22-11-5-2-6-12-22)31(28(32)35)19-21-9-3-1-4-10-21/h1-6,9-16,26H,7-8,17-20H2,(H,29,33) |
| InChIKey | TZPVOTKKUYWENQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|