C28H29N3O3 — CID 55622160
2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-methyl-6-propan-2-ylphenyl)acetamide (PubChem CID 55622160) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-methyl-6-propan-2-ylphenyl)acetamide.
| Compound Name | 2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-methyl-6-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55622160 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-methyl-6-propan-2-ylphenyl)acetamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)CN1C(=O)C(c2ccccc2)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C28H29N3O3/c1-19(2)23-16-10-11-20(3)25(23)29-24(32)18-31-27(33)26(22-14-8-5-9-15-22)30(28(31)34)17-21-12-6-4-7-13-21/h4-16,19,26H,17-18H2,1-3H3,(H,29,32) |
| InChIKey | DRAVZQAUAWKEDE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|