C21H29N3O3 — CID 7265503
2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-(2-methyl-6-propan-2-ylphenyl)acetamide (PubChem CID 7265503) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-(2-methyl-6-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-(2-methyl-6-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 7265503 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-(2-methyl-6-propan-2-ylphenyl)acetamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)CN1C(=O)N[C@@]2(CCCC[C@H]2C)C1=O |
| InChI | InChI=1S/C21H29N3O3/c1-13(2)16-10-7-8-14(3)18(16)22-17(25)12-24-19(26)21(23-20(24)27)11-6-5-9-15(21)4/h7-8,10,13,15H,5-6,9,11-12H2,1-4H3,(H,22,25)(H,23,27)/t15-,21-/m1/s1 |
| InChIKey | RIENZBJCJXNXLO-QVKFZJNVSA-N |
| XLogP | 3.56 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|