C20H26N4O4 — CID 9474289
N-[(2,3-dimethylphenyl)carbamoyl]-2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 9474289) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[(2,3-dimethylphenyl)carbamoyl]-2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-[(2,3-dimethylphenyl)carbamoyl]-2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 9474289 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[(2,3-dimethylphenyl)carbamoyl]-2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | Cc1cccc(NC(=O)NC(=O)CN2C(=O)N[C@@]3(CCCC[C@H]3C)C2=O)c1C |
| InChI | InChI=1S/C20H26N4O4/c1-12-7-6-9-15(14(12)3)21-18(27)22-16(25)11-24-17(26)20(23-19(24)28)10-5-4-8-13(20)2/h6-7,9,13H,4-5,8,10-11H2,1-3H3,(H,23,28)(H2,21,22,25,27)/t13-,20-/m1/s1 |
| InChIKey | LIXOSAZICXWJFU-ZUOKHONESA-N |
| XLogP | 2.45 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|