C24H19ClN4O5 — CID 55622502
2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-chloro-5-nitrophenyl)acetamide (PubChem CID 55622502) has the molecular formula C24H19ClN4O5 and a molecular weight of 478.89 g/mol. Its IUPAC name is 2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-chloro-5-nitrophenyl)acetamide.
| Compound Name | 2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-chloro-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 55622502 |
| Molecular Formula | C24H19ClN4O5 |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-chloro-5-nitrophenyl)acetamide |
| SMILES | O=C(CN1C(=O)C(c2ccccc2)N(Cc2ccccc2)C1=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C24H19ClN4O5/c25-19-12-11-18(29(33)34)13-20(19)26-21(30)15-28-23(31)22(17-9-5-2-6-10-17)27(24(28)32)14-16-7-3-1-4-8-16/h1-13,22H,14-15H2,(H,26,30) |
| InChIKey | BHCFVIQSEMBSCT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|