C24H19N5O3S — CID 55622331
N-(2,1,3-benzothiadiazol-4-yl)-2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide (PubChem CID 55622331) has the molecular formula C24H19N5O3S and a molecular weight of 457.52 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-yl)-2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide.
| Compound Name | N-(2,1,3-benzothiadiazol-4-yl)-2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 55622331 |
| Molecular Formula | C24H19N5O3S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-yl)-2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
| SMILES | O=C(CN1C(=O)C(c2ccccc2)N(Cc2ccccc2)C1=O)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C24H19N5O3S/c30-20(25-18-12-7-13-19-21(18)27-33-26-19)15-29-23(31)22(17-10-5-2-6-11-17)28(24(29)32)14-16-8-3-1-4-9-16/h1-13,22H,14-15H2,(H,25,30) |
| InChIKey | GXXYXMBIQGMSJB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|