C24H23N3O3S — CID 78881064
2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 78881064) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is 2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(1-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(1-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 78881064 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | CC(NC(=O)CN1C(=O)C(c2ccccc2)N(Cc2ccccc2)C1=O)c1cccs1 |
| InChI | InChI=1S/C24H23N3O3S/c1-17(20-13-8-14-31-20)25-21(28)16-27-23(29)22(19-11-6-3-7-12-19)26(24(27)30)15-18-9-4-2-5-10-18/h2-14,17,22H,15-16H2,1H3,(H,25,28) |
| InChIKey | VLOJABREABEWAY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|