C27H32N4O5 — CID 56505140
tert-butyl 4-[2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]piperazine-1-carboxylate (PubChem CID 56505140) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is tert-butyl 4-[2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 56505140 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | tert-butyl 4-[2-(3-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)CN2C(=O)C(c3ccccc3)N(Cc3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C27H32N4O5/c1-27(2,3)36-26(35)29-16-14-28(15-17-29)22(32)19-31-24(33)23(21-12-8-5-9-13-21)30(25(31)34)18-20-10-6-4-7-11-20/h4-13,23H,14-19H2,1-3H3 |
| InChIKey | DWFBLTNFVSRTDF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|