C22H25N3O2 — CID 177410052
1-[(E)-benzylideneamino]-3-hexyl-5-phenylimidazolidine-2,4-dione (PubChem CID 177410052) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-[(E)-benzylideneamino]-3-hexyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | 1-[(E)-benzylideneamino]-3-hexyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 177410052 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 1-[(E)-benzylideneamino]-3-hexyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CCCCCCN1C(=O)C(c2ccccc2)N(/N=C/c2ccccc2)C1=O |
| InChI | InChI=1S/C22H25N3O2/c1-2-3-4-11-16-24-21(26)20(19-14-9-6-10-15-19)25(22(24)27)23-17-18-12-7-5-8-13-18/h5-10,12-15,17,20H,2-4,11,16H2,1H3/b23-17+ |
| InChIKey | HSHCKHNKWKJKLN-HAVVHWLPSA-N |
| XLogP | 4.61 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|