C27H46N4O2 — CID 70594836
1,3-bis[(dibutylamino)methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 70594836) has the molecular formula C27H46N4O2 and a molecular weight of 458.69 g/mol. Its IUPAC name is 1,3-bis[(dibutylamino)methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | 1,3-bis[(dibutylamino)methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70594836 |
| Molecular Formula | C27H46N4O2 |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.36 |
| IUPAC Name | 1,3-bis[(dibutylamino)methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | CCCCN(CCCC)CN1C(=O)C(c2ccccc2)N(CN(CCCC)CCCC)C1=O |
| InChI | InChI=1S/C27H46N4O2/c1-5-9-18-28(19-10-6-2)22-30-25(24-16-14-13-15-17-24)26(32)31(27(30)33)23-29(20-11-7-3)21-12-8-4/h13-17,25H,5-12,18-23H2,1-4H3 |
| InChIKey | BBZYLAPEXZTCAG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|