C16H30N2O2 — CID 18730690
1,3-diheptyl-1,3-diazetidine-2,4-dione (PubChem CID 18730690) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1,3-diheptyl-1,3-diazetidine-2,4-dione.
| Compound Name | 1,3-diheptyl-1,3-diazetidine-2,4-dione |
|---|---|
| PubChem CID | 18730690 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1,3-diheptyl-1,3-diazetidine-2,4-dione |
| SMILES | CCCCCCCN1C(=O)N(CCCCCCC)C1=O |
| InChI | InChI=1S/C16H30N2O2/c1-3-5-7-9-11-13-17-15(19)18(16(17)20)14-12-10-8-6-4-2/h3-14H2,1-2H3 |
| InChIKey | LEHPUZFVDHIRTC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|