C21H38N2O2S — CID 86042551
1,3-di(nonyl)-2-sulfanylideneimidazolidine-4,5-dione (PubChem CID 86042551) has the molecular formula C21H38N2O2S and a molecular weight of 382.61 g/mol. Its IUPAC name is 1,3-di(nonyl)-2-sulfanylideneimidazolidine-4,5-dione.
| Compound Name | 1,3-di(nonyl)-2-sulfanylideneimidazolidine-4,5-dione |
|---|---|
| PubChem CID | 86042551 |
| Molecular Formula | C21H38N2O2S |
| Molecular Weight | 382.61 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 1,3-di(nonyl)-2-sulfanylideneimidazolidine-4,5-dione |
| SMILES | CCCCCCCCCN1C(=O)C(=O)N(CCCCCCCCC)C1=S |
| InChI | InChI=1S/C21H38N2O2S/c1-3-5-7-9-11-13-15-17-22-19(24)20(25)23(21(22)26)18-16-14-12-10-8-6-4-2/h3-18H2,1-2H3 |
| InChIKey | WSHBTWZQWPMNOI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|