C14H23NO2S — CID 75146607
5-octyl-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione (PubChem CID 75146607) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 5-octyl-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 5-octyl-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 75146607 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 5-octyl-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCCCCCN1C(=O)C2CSCC2C1=O |
| InChI | InChI=1S/C14H23NO2S/c1-2-3-4-5-6-7-8-15-13(16)11-9-18-10-12(11)14(15)17/h11-12H,2-10H2,1H3 |
| InChIKey | OIBZLOQZVXWVMS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|