C12H19NO2S — CID 46201750
(3aS,6aR)-5-hexyl-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione (PubChem CID 46201750) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is (3aS,6aR)-5-hexyl-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | (3aS,6aR)-5-hexyl-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 46201750 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (3aS,6aR)-5-hexyl-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCCCN1C(=O)[C@H]2CSC[C@H]2C1=O |
| InChI | InChI=1S/C12H19NO2S/c1-2-3-4-5-6-13-11(14)9-7-16-8-10(9)12(13)15/h9-10H,2-8H2,1H3/t9-,10+ |
| InChIKey | AFWFSNTYCKIBLR-AOOOYVTPSA-N |
| XLogP | 1.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|