C12H21NO4 — CID 14669715
(3R,4R)-3,4-dihydroxy-1-octylpyrrolidine-2,5-dione (PubChem CID 14669715) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is (3R,4R)-3,4-dihydroxy-1-octylpyrrolidine-2,5-dione.
| Compound Name | (3R,4R)-3,4-dihydroxy-1-octylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 14669715 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | (3R,4R)-3,4-dihydroxy-1-octylpyrrolidine-2,5-dione |
| SMILES | CCCCCCCCN1C(=O)[C@H](O)[C@@H](O)C1=O |
| InChI | InChI=1S/C12H21NO4/c1-2-3-4-5-6-7-8-13-11(16)9(14)10(15)12(13)17/h9-10,14-15H,2-8H2,1H3/t9-,10-/m1/s1 |
| InChIKey | VWKSRFLQJIVJNB-NXEZZACHSA-N |
| XLogP | 0.44 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|