C13H18O2S — CID 70637114
2-(2-phenylpropyl)thiolane 1,1-dioxide (PubChem CID 70637114) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is 2-(2-phenylpropyl)thiolane 1,1-dioxide.
| Compound Name | 2-(2-phenylpropyl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 70637114 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-(2-phenylpropyl)thiolane 1,1-dioxide |
| SMILES | CC(CC1CCCS1(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C13H18O2S/c1-11(12-6-3-2-4-7-12)10-13-8-5-9-16(13,14)15/h2-4,6-7,11,13H,5,8-10H2,1H3 |
| InChIKey | QUYRXFPDVNRGTL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |