C18H20O7 — CID 54265099
2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(1-phenylpropyl)butanedioic acid (PubChem CID 54265099) has the molecular formula C18H20O7 and a molecular weight of 348.35 g/mol. Its IUPAC name is 2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(1-phenylpropyl)butanedioic acid.
| Compound Name | 2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(1-phenylpropyl)butanedioic acid |
|---|---|
| PubChem CID | 54265099 |
| Molecular Formula | C18H20O7 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(1-phenylpropyl)butanedioic acid |
| SMILES | CCC(c1ccccc1)C(C(=O)O)C(C(=O)O)C1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C18H20O7/c1-3-11(10-7-5-4-6-8-10)13(15(19)20)14(16(21)22)12-9(2)17(23)25-18(12)24/h4-9,11-14H,3H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | RGEZJFVAAATCBZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|