C23H26F6O13 — CID 23557998
5-acetyloxy-4-(3,3,4,4,5,5-hexafluoropentoxycarbonyl)-1-(4-methyl-2,5-dioxooxolan-3-yl)heptane-1,2,3-tricarboxylic acid (PubChem CID 23557998) has the molecular formula C23H26F6O13 and a molecular weight of 624.44 g/mol. Its IUPAC name is 5-acetyloxy-4-(3,3,4,4,5,5-hexafluoropentoxycarbonyl)-1-(4-methyl-2,5-dioxooxolan-3-yl)heptane-1,2,3-tricarboxylic acid.
| Compound Name | 5-acetyloxy-4-(3,3,4,4,5,5-hexafluoropentoxycarbonyl)-1-(4-methyl-2,5-dioxooxolan-3-yl)heptane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 23557998 |
| Molecular Formula | C23H26F6O13 |
| Molecular Weight | 624.44 g/mol |
| Exact Mass | 624.13 |
| IUPAC Name | 5-acetyloxy-4-(3,3,4,4,5,5-hexafluoropentoxycarbonyl)-1-(4-methyl-2,5-dioxooxolan-3-yl)heptane-1,2,3-tricarboxylic acid |
| SMILES | CCC(OC(C)=O)C(C(=O)OCCC(F)(F)C(F)(F)C(F)F)C(C(=O)O)C(C(=O)O)C(C(=O)O)C1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C23H26F6O13/c1-4-9(41-8(3)30)11(19(38)40-6-5-22(26,27)23(28,29)21(24)25)13(16(33)34)14(17(35)36)12(15(31)32)10-7(2)18(37)42-20(10)39/h7,9-14,21H,4-6H2,1-3H3,(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | WOPNSGWQTZNQAE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 207.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|