C20H27F11O4 — CID 21049974
4-O-[3,3,4,5,5,6,6-heptafluoro-4-(1,1,2,2-tetrafluoroethyl)hexyl] 1-O-hexyl 2-ethylbutanedioate (PubChem CID 21049974) has the molecular formula C20H27F11O4 and a molecular weight of 540.41 g/mol. Its IUPAC name is 4-O-[3,3,4,5,5,6,6-heptafluoro-4-(1,1,2,2-tetrafluoroethyl)hexyl] 1-O-hexyl 2-ethylbutanedioate.
| Compound Name | 4-O-[3,3,4,5,5,6,6-heptafluoro-4-(1,1,2,2-tetrafluoroethyl)hexyl] 1-O-hexyl 2-ethylbutanedioate |
|---|---|
| PubChem CID | 21049974 |
| Molecular Formula | C20H27F11O4 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 4-O-[3,3,4,5,5,6,6-heptafluoro-4-(1,1,2,2-tetrafluoroethyl)hexyl] 1-O-hexyl 2-ethylbutanedioate |
| SMILES | CCCCCCOC(=O)C(CC)CC(=O)OCCC(F)(F)C(F)(C(F)(F)C(F)F)C(F)(F)C(F)F |
| InChI | InChI=1S/C20H27F11O4/c1-3-5-6-7-9-35-14(33)12(4-2)11-13(32)34-10-8-17(25,26)20(31,18(27,28)15(21)22)19(29,30)16(23)24/h12,15-16H,3-11H2,1-2H3 |
| InChIKey | BHKPNZOAEFMLGK-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|