C16H25F5O7S — CID 20783195
4-O-octyl 1-O-(3,3,4,4,4-pentafluorobutyl) 2-(trioxidanylsulfanyl)butanedioate (PubChem CID 20783195) has the molecular formula C16H25F5O7S and a molecular weight of 456.43 g/mol. Its IUPAC name is 4-O-octyl 1-O-(3,3,4,4,4-pentafluorobutyl) 2-(trioxidanylsulfanyl)butanedioate.
| Compound Name | 4-O-octyl 1-O-(3,3,4,4,4-pentafluorobutyl) 2-(trioxidanylsulfanyl)butanedioate |
|---|---|
| PubChem CID | 20783195 |
| Molecular Formula | C16H25F5O7S |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 4-O-octyl 1-O-(3,3,4,4,4-pentafluorobutyl) 2-(trioxidanylsulfanyl)butanedioate |
| SMILES | CCCCCCCCOC(=O)CC(SOOO)C(=O)OCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H25F5O7S/c1-2-3-4-5-6-7-9-25-13(22)11-12(29-28-27-24)14(23)26-10-8-15(17,18)16(19,20)21/h12,24H,2-11H2,1H3 |
| InChIKey | HSMUBJCDPAJXMF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|