C17H24F8O7S — CID 21057579
1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-octyl 2-(trioxidanylsulfanyl)butanedioate (PubChem CID 21057579) has the molecular formula C17H24F8O7S and a molecular weight of 524.42 g/mol. Its IUPAC name is 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-octyl 2-(trioxidanylsulfanyl)butanedioate.
| Compound Name | 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-octyl 2-(trioxidanylsulfanyl)butanedioate |
|---|---|
| PubChem CID | 21057579 |
| Molecular Formula | C17H24F8O7S |
| Molecular Weight | 524.42 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-octyl 2-(trioxidanylsulfanyl)butanedioate |
| SMILES | CCCCCCCCOC(=O)CC(SOOO)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C17H24F8O7S/c1-2-3-4-5-6-7-8-29-12(26)9-11(33-32-31-28)13(27)30-10-15(20,21)17(24,25)16(22,23)14(18)19/h11,14,28H,2-10H2,1H3 |
| InChIKey | UYEUGNWGAZSDMD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.42 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|