About 4-O-octyl 1-O-pentyl 2-(trioxidanylsulfanyl)butanedioate
4-O-octyl 1-O-pentyl 2-(trioxidanylsulfanyl)butanedioate (PubChem CID 59991553) has the molecular formula C17H32O7S
and a molecular weight of 380.50 g/mol. Its IUPAC name is 4-O-octyl 1-O-pentyl 2-(trioxidanylsulfanyl)butanedioate.
Molecular Properties
| Compound Name | 4-O-octyl 1-O-pentyl 2-(trioxidanylsulfanyl)butanedioate |
| PubChem CID | 59991553 |
| Molecular Formula | C17H32O7S |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 4-O-octyl 1-O-pentyl 2-(trioxidanylsulfanyl)butanedioate |
| SMILES | CCCCCCCCOC(=O)CC(SOOO)C(=O)OCCCCC |
| InChI | InChI=1S/C17H32O7S/c1-3-5-7-8-9-11-12-21-16(18)14-15(25-24-23-20)17(19)22-13-10-6-4-2/h15,20H,3-14H2,1-2H3 |
| InChIKey | FRXCSSOAJDOMNV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-O-octyl 1-O-pentyl 2-(trioxidanylsulfanyl)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-octyl 1-O-pentyl 2-(trioxidanylsulfanyl)butanedioate?
The IUPAC name of 4-O-octyl 1-O-pentyl 2-(trioxidanylsulfanyl)butanedioate (CID 59991553) is 4-O-octyl 1-O-pentyl 2-(trioxidanylsulfanyl)butanedioate.
What is the SMILES notation for 4-O-octyl 1-O-pentyl 2-(trioxidanylsulfanyl)butanedioate?
The canonical SMILES for 4-O-octyl 1-O-pentyl 2-(trioxidanylsulfanyl)butanedioate is CCCCCCCCOC(=O)CC(SOOO)C(=O)OCCCCC.
What is the InChIKey of 4-O-octyl 1-O-pentyl 2-(trioxidanylsulfanyl)butanedioate?
The InChIKey is FRXCSSOAJDOMNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O7S/c1-3-5-7-8-9-11-12-21-16(18)14-15(25-24-23-20)17(19)22-13-10-6-4-2/h15,20H,3-14H2,1-2H3.
What are the key properties of 4-O-octyl 1-O-pentyl 2-(trioxidanylsulfanyl)butanedioate?
4-O-octyl 1-O-pentyl 2-(trioxidanylsulfanyl)butanedioate has a molecular weight of 380.50 g/mol, XLogP of 4.45, 17 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-octyl 1-O-pentyl 2-(trioxidanylsulfanyl)butanedioate is sourced from PubChem (CID 59991553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).