C14H26O7S — CID 21028529
bis(3-methylbutyl) 2-(trioxidanylsulfanyl)butanedioate (PubChem CID 21028529) has the molecular formula C14H26O7S and a molecular weight of 338.42 g/mol. Its IUPAC name is bis(3-methylbutyl) 2-(trioxidanylsulfanyl)butanedioate.
| Compound Name | bis(3-methylbutyl) 2-(trioxidanylsulfanyl)butanedioate |
|---|---|
| PubChem CID | 21028529 |
| Molecular Formula | C14H26O7S |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | bis(3-methylbutyl) 2-(trioxidanylsulfanyl)butanedioate |
| SMILES | CC(C)CCOC(=O)CC(SOOO)C(=O)OCCC(C)C |
| InChI | InChI=1S/C14H26O7S/c1-10(2)5-7-18-13(15)9-12(22-21-20-17)14(16)19-8-6-11(3)4/h10-12,17H,5-9H2,1-4H3 |
| InChIKey | BPLZNEOMSOMAOY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|