C16H14F16O7S — CID 58898969
bis(3,3,4,4,5,5,6,6-octafluorohexyl) 2-(trioxidanylsulfanyl)butanedioate (PubChem CID 58898969) has the molecular formula C16H14F16O7S and a molecular weight of 654.32 g/mol. Its IUPAC name is bis(3,3,4,4,5,5,6,6-octafluorohexyl) 2-(trioxidanylsulfanyl)butanedioate.
| Compound Name | bis(3,3,4,4,5,5,6,6-octafluorohexyl) 2-(trioxidanylsulfanyl)butanedioate |
|---|---|
| PubChem CID | 58898969 |
| Molecular Formula | C16H14F16O7S |
| Molecular Weight | 654.32 g/mol |
| Exact Mass | 654.02 |
| IUPAC Name | bis(3,3,4,4,5,5,6,6-octafluorohexyl) 2-(trioxidanylsulfanyl)butanedioate |
| SMILES | O=C(CC(SOOO)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)F)OCCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H14F16O7S/c17-9(18)13(25,26)15(29,30)11(21,22)1-3-36-7(33)5-6(40-39-38-35)8(34)37-4-2-12(23,24)16(31,32)14(27,28)10(19)20/h6,9-10,35H,1-5H2 |
| InChIKey | JMFMQWDGXWEHRR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.32 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|