C20H12F25NaO7S — CID 23600019
sodium 4-O-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl) 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-oxidoperoxysulfanylbutanedioate (PubChem CID 23600019) has the molecular formula C20H12F25NaO7S and a molecular weight of 894.32 g/mol. Its IUPAC name is sodium 4-O-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl) 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-oxidoperoxysulfanylbutanedioate.
| Compound Name | sodium 4-O-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl) 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-oxidoperoxysulfanylbutanedioate |
|---|---|
| PubChem CID | 23600019 |
| Molecular Formula | C20H12F25NaO7S |
| Molecular Weight | 894.32 g/mol |
| Exact Mass | 893.98 |
| IUPAC Name | sodium 4-O-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl) 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-oxidoperoxysulfanylbutanedioate |
| SMILES | O=C(CC(SOO[O-])C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F.[Na+] |
| InChI | InChI=1S/C20H13F25O7S.Na/c21-9(22)12(27,28)15(33,34)17(37,38)18(39,40)16(35,36)13(29,30)10(23,24)1-3-49-7(46)5-6(53-52-51-48)8(47)50-4-2-11(25,26)14(31,32)19(41,42)20(43,44)45;/h6,9,48H,1-5H2;/q;+1/p-1 |
| InChIKey | BWNBPPVBEKTKFH-UHFFFAOYSA-M |
| XLogP | 4.67 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.32 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|