C20H28F9LiO7S — CID 20783178
lithium 4-O-decyl 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-oxidoperoxysulfanylbutanedioate (PubChem CID 20783178) has the molecular formula C20H28F9LiO7S and a molecular weight of 590.43 g/mol. Its IUPAC name is lithium 4-O-decyl 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-oxidoperoxysulfanylbutanedioate.
| Compound Name | lithium 4-O-decyl 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-oxidoperoxysulfanylbutanedioate |
|---|---|
| PubChem CID | 20783178 |
| Molecular Formula | C20H28F9LiO7S |
| Molecular Weight | 590.43 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | lithium 4-O-decyl 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-oxidoperoxysulfanylbutanedioate |
| SMILES | CCCCCCCCCCOC(=O)CC(SOO[O-])C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Li+] |
| InChI | InChI=1S/C20H29F9O7S.Li/c1-2-3-4-5-6-7-8-9-11-33-15(30)13-14(37-36-35-32)16(31)34-12-10-17(21,22)18(23,24)19(25,26)20(27,28)29;/h14,32H,2-13H2,1H3;/q;+1/p-1 |
| InChIKey | KSVOVOIZGZUNCI-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|