C16H11F18LiO7S — CID 23574208
lithium bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-oxidoperoxysulfanylbutanedioate (PubChem CID 23574208) has the molecular formula C16H11F18LiO7S and a molecular weight of 696.23 g/mol. Its IUPAC name is lithium bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-oxidoperoxysulfanylbutanedioate.
| Compound Name | lithium bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-oxidoperoxysulfanylbutanedioate |
|---|---|
| PubChem CID | 23574208 |
| Molecular Formula | C16H11F18LiO7S |
| Molecular Weight | 696.23 g/mol |
| Exact Mass | 696.01 |
| IUPAC Name | lithium bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-oxidoperoxysulfanylbutanedioate |
| SMILES | O=C(CC(SOO[O-])C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Li+] |
| InChI | InChI=1S/C16H12F18O7S.Li/c17-9(18,11(21,22)13(25,26)15(29,30)31)1-3-38-7(35)5-6(42-41-40-37)8(36)39-4-2-10(19,20)12(23,24)14(27,28)16(32,33)34;/h6,37H,1-5H2;/q;+1/p-1 |
| InChIKey | HPYBHZWQEDDQFI-UHFFFAOYSA-M |
| XLogP | 2.42 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|