C25H29F18NaO7S — CID 20768677
sodium bis(7,7,8,8,9,9,10,10,10-nonafluorodecyl) 2-(oxidoperoxysulfanylmethyl)butanedioate (PubChem CID 20768677) has the molecular formula C25H29F18NaO7S and a molecular weight of 838.52 g/mol. Its IUPAC name is sodium bis(7,7,8,8,9,9,10,10,10-nonafluorodecyl) 2-(oxidoperoxysulfanylmethyl)butanedioate.
| Compound Name | sodium bis(7,7,8,8,9,9,10,10,10-nonafluorodecyl) 2-(oxidoperoxysulfanylmethyl)butanedioate |
|---|---|
| PubChem CID | 20768677 |
| Molecular Formula | C25H29F18NaO7S |
| Molecular Weight | 838.52 g/mol |
| Exact Mass | 838.12 |
| IUPAC Name | sodium bis(7,7,8,8,9,9,10,10,10-nonafluorodecyl) 2-(oxidoperoxysulfanylmethyl)butanedioate |
| SMILES | O=C(CC(CSOO[O-])C(=O)OCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C25H30F18O7S.Na/c26-18(27,20(30,31)22(34,35)24(38,39)40)9-5-1-3-7-11-47-16(44)13-15(14-51-50-49-46)17(45)48-12-8-4-2-6-10-19(28,29)21(32,33)23(36,37)25(41,42)43;/h15,46H,1-14H2;/q;+1/p-1 |
| InChIKey | WDXWKHHALQIALO-UHFFFAOYSA-M |
| XLogP | 5.79 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|