C18H17F16NaO7S — CID 58883987
sodium bis(3,3,4,4,5,5,6,6-octafluorohexyl) 2-(2-oxidoperoxysulfanylethyl)butanedioate (PubChem CID 58883987) has the molecular formula C18H17F16NaO7S and a molecular weight of 704.35 g/mol. Its IUPAC name is sodium bis(3,3,4,4,5,5,6,6-octafluorohexyl) 2-(2-oxidoperoxysulfanylethyl)butanedioate.
| Compound Name | sodium bis(3,3,4,4,5,5,6,6-octafluorohexyl) 2-(2-oxidoperoxysulfanylethyl)butanedioate |
|---|---|
| PubChem CID | 58883987 |
| Molecular Formula | C18H17F16NaO7S |
| Molecular Weight | 704.35 g/mol |
| Exact Mass | 704.03 |
| IUPAC Name | sodium bis(3,3,4,4,5,5,6,6-octafluorohexyl) 2-(2-oxidoperoxysulfanylethyl)butanedioate |
| SMILES | O=C(CC(CCSOO[O-])C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)F)OCCC(F)(F)C(F)(F)C(F)(F)C(F)F.[Na+] |
| InChI | InChI=1S/C18H18F16O7S.Na/c19-11(20)15(27,28)17(31,32)13(23,24)2-4-38-9(35)7-8(1-6-42-41-40-37)10(36)39-5-3-14(25,26)18(33,34)16(29,30)12(21)22;/h8,11-12,37H,1-7H2;/q;+1/p-1 |
| InChIKey | CJKQGIPYFCPSDK-UHFFFAOYSA-M |
| XLogP | 2.47 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|