C18H26F8O7S — CID 58933328
4-O-(3,3,4,4,5,5,6,6-octafluorohexyl) 1-O-octyl 2-(trioxidanylsulfanyl)butanedioate (PubChem CID 58933328) has the molecular formula C18H26F8O7S and a molecular weight of 538.45 g/mol. Its IUPAC name is 4-O-(3,3,4,4,5,5,6,6-octafluorohexyl) 1-O-octyl 2-(trioxidanylsulfanyl)butanedioate.
| Compound Name | 4-O-(3,3,4,4,5,5,6,6-octafluorohexyl) 1-O-octyl 2-(trioxidanylsulfanyl)butanedioate |
|---|---|
| PubChem CID | 58933328 |
| Molecular Formula | C18H26F8O7S |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 4-O-(3,3,4,4,5,5,6,6-octafluorohexyl) 1-O-octyl 2-(trioxidanylsulfanyl)butanedioate |
| SMILES | CCCCCCCCOC(=O)C(CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)F)SOOO |
| InChI | InChI=1S/C18H26F8O7S/c1-2-3-4-5-6-7-9-31-14(28)12(34-33-32-29)11-13(27)30-10-8-16(21,22)18(25,26)17(23,24)15(19)20/h12,15,29H,2-11H2,1H3 |
| InChIKey | QJLNANSABDCYHF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|