About 4-O-(2-butoxyethyl) 1-O-hexyl 2-(trioxidanylsulfanyl)butanedioate
4-O-(2-butoxyethyl) 1-O-hexyl 2-(trioxidanylsulfanyl)butanedioate (PubChem CID 59791310) has the molecular formula C16H30O8S
and a molecular weight of 382.48 g/mol. Its IUPAC name is 4-O-(2-butoxyethyl) 1-O-hexyl 2-(trioxidanylsulfanyl)butanedioate.
Molecular Properties
| Compound Name | 4-O-(2-butoxyethyl) 1-O-hexyl 2-(trioxidanylsulfanyl)butanedioate |
| PubChem CID | 59791310 |
| Molecular Formula | C16H30O8S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 4-O-(2-butoxyethyl) 1-O-hexyl 2-(trioxidanylsulfanyl)butanedioate |
| SMILES | CCCCCCOC(=O)C(CC(=O)OCCOCCCC)SOOO |
| InChI | InChI=1S/C16H30O8S/c1-3-5-7-8-10-22-16(18)14(25-24-23-19)13-15(17)21-12-11-20-9-6-4-2/h14,19H,3-13H2,1-2H3 |
| InChIKey | SHJGHYOXQYTXGC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(2-butoxyethyl) 1-O-hexyl 2-(trioxidanylsulfanyl)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(2-butoxyethyl) 1-O-hexyl 2-(trioxidanylsulfanyl)butanedioate?
The IUPAC name of 4-O-(2-butoxyethyl) 1-O-hexyl 2-(trioxidanylsulfanyl)butanedioate (CID 59791310) is 4-O-(2-butoxyethyl) 1-O-hexyl 2-(trioxidanylsulfanyl)butanedioate.
What is the SMILES notation for 4-O-(2-butoxyethyl) 1-O-hexyl 2-(trioxidanylsulfanyl)butanedioate?
The canonical SMILES for 4-O-(2-butoxyethyl) 1-O-hexyl 2-(trioxidanylsulfanyl)butanedioate is CCCCCCOC(=O)C(CC(=O)OCCOCCCC)SOOO.
What is the InChIKey of 4-O-(2-butoxyethyl) 1-O-hexyl 2-(trioxidanylsulfanyl)butanedioate?
The InChIKey is SHJGHYOXQYTXGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O8S/c1-3-5-7-8-10-22-16(18)14(25-24-23-19)13-15(17)21-12-11-20-9-6-4-2/h14,19H,3-13H2,1-2H3.
What are the key properties of 4-O-(2-butoxyethyl) 1-O-hexyl 2-(trioxidanylsulfanyl)butanedioate?
4-O-(2-butoxyethyl) 1-O-hexyl 2-(trioxidanylsulfanyl)butanedioate has a molecular weight of 382.48 g/mol, XLogP of 3.30, 17 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(2-butoxyethyl) 1-O-hexyl 2-(trioxidanylsulfanyl)butanedioate is sourced from PubChem (CID 59791310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).