C18H24F9NaO7S — CID 20783125
sodium 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 4-O-octyl 2-oxidoperoxysulfanylbutanedioate (PubChem CID 20783125) has the molecular formula C18H24F9NaO7S and a molecular weight of 578.42 g/mol. Its IUPAC name is sodium 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 4-O-octyl 2-oxidoperoxysulfanylbutanedioate.
| Compound Name | sodium 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 4-O-octyl 2-oxidoperoxysulfanylbutanedioate |
|---|---|
| PubChem CID | 20783125 |
| Molecular Formula | C18H24F9NaO7S |
| Molecular Weight | 578.42 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | sodium 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 4-O-octyl 2-oxidoperoxysulfanylbutanedioate |
| SMILES | CCCCCCCCOC(=O)CC(SOO[O-])C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C18H25F9O7S.Na/c1-2-3-4-5-6-7-9-31-13(28)11-12(35-34-33-30)14(29)32-10-8-15(19,20)16(21,22)17(23,24)18(25,26)27;/h12,30H,2-11H2,1H3;/q;+1/p-1 |
| InChIKey | UEMXLAWSISRKME-UHFFFAOYSA-M |
| XLogP | 1.93 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|