C18H17F9O7S — CID 20783128
1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 4-O-(2-phenylethyl) 2-(trioxidanylsulfanyl)butanedioate (PubChem CID 20783128) has the molecular formula C18H17F9O7S and a molecular weight of 548.38 g/mol. Its IUPAC name is 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 4-O-(2-phenylethyl) 2-(trioxidanylsulfanyl)butanedioate.
| Compound Name | 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 4-O-(2-phenylethyl) 2-(trioxidanylsulfanyl)butanedioate |
|---|---|
| PubChem CID | 20783128 |
| Molecular Formula | C18H17F9O7S |
| Molecular Weight | 548.38 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 4-O-(2-phenylethyl) 2-(trioxidanylsulfanyl)butanedioate |
| SMILES | O=C(CC(SOOO)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCCc1ccccc1 |
| InChI | InChI=1S/C18H17F9O7S/c19-15(20,16(21,22)17(23,24)18(25,26)27)7-9-32-14(29)12(35-34-33-30)10-13(28)31-8-6-11-4-2-1-3-5-11/h1-5,12,30H,6-10H2 |
| InChIKey | XESFKGNLQYNNCH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|