C9H9F9O5S — CID 20783132
3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-(trioxidanylsulfanyl)propanoate (PubChem CID 20783132) has the molecular formula C9H9F9O5S and a molecular weight of 400.22 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-(trioxidanylsulfanyl)propanoate.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-(trioxidanylsulfanyl)propanoate |
|---|---|
| PubChem CID | 20783132 |
| Molecular Formula | C9H9F9O5S |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-(trioxidanylsulfanyl)propanoate |
| SMILES | CC(SOOO)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F9O5S/c1-4(24-23-22-20)5(19)21-3-2-6(10,11)7(12,13)8(14,15)9(16,17)18/h4,20H,2-3H2,1H3 |
| InChIKey | MEBMUFNOLXGSOF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|