C25H30F18O7S — CID 58798300
1-O-(1,1,1,2,2,3,3,4,4,9,9,10,10,11,11,12,12,12-octadecafluoro-5-methyldodecan-6-yl) 4-O-octyl 2-(trioxidanylsulfanyl)butanedioate (PubChem CID 58798300) has the molecular formula C25H30F18O7S and a molecular weight of 816.54 g/mol. Its IUPAC name is 1-O-(1,1,1,2,2,3,3,4,4,9,9,10,10,11,11,12,12,12-octadecafluoro-5-methyldodecan-6-yl) 4-O-octyl 2-(trioxidanylsulfanyl)butanedioate.
| Compound Name | 1-O-(1,1,1,2,2,3,3,4,4,9,9,10,10,11,11,12,12,12-octadecafluoro-5-methyldodecan-6-yl) 4-O-octyl 2-(trioxidanylsulfanyl)butanedioate |
|---|---|
| PubChem CID | 58798300 |
| Molecular Formula | C25H30F18O7S |
| Molecular Weight | 816.54 g/mol |
| Exact Mass | 816.14 |
| IUPAC Name | 1-O-(1,1,1,2,2,3,3,4,4,9,9,10,10,11,11,12,12,12-octadecafluoro-5-methyldodecan-6-yl) 4-O-octyl 2-(trioxidanylsulfanyl)butanedioate |
| SMILES | CCCCCCCCOC(=O)CC(SOOO)C(=O)OC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H30F18O7S/c1-3-4-5-6-7-8-11-47-16(44)12-15(51-50-49-46)17(45)48-14(9-10-18(26,27)20(30,31)22(34,35)24(38,39)40)13(2)19(28,29)21(32,33)23(36,37)25(41,42)43/h13-15,46H,3-12H2,1-2H3 |
| InChIKey | XKEBKSLUQBTBIG-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.54 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|