C20H24F16NO4+ — CID 20783134
[1,5-bis(3,3,4,4,5,5,6,6-octafluorohexoxy)-1,5-dioxopentan-2-yl]-trimethylazanium (PubChem CID 20783134) has the molecular formula C20H24F16NO4+ and a molecular weight of 646.38 g/mol. Its IUPAC name is [1,5-bis(3,3,4,4,5,5,6,6-octafluorohexoxy)-1,5-dioxopentan-2-yl]-trimethylazanium.
| Compound Name | [1,5-bis(3,3,4,4,5,5,6,6-octafluorohexoxy)-1,5-dioxopentan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 20783134 |
| Molecular Formula | C20H24F16NO4+ |
| Molecular Weight | 646.38 g/mol |
| Exact Mass | 646.14 |
| IUPAC Name | [1,5-bis(3,3,4,4,5,5,6,6-octafluorohexoxy)-1,5-dioxopentan-2-yl]-trimethylazanium |
| SMILES | C[N+](C)(C)C(CCC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)F)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C20H24F16NO4/c1-37(2,3)10(12(39)41-9-7-16(27,28)20(35,36)18(31,32)14(23)24)4-5-11(38)40-8-6-15(25,26)19(33,34)17(29,30)13(21)22/h10,13-14H,4-9H2,1-3H3/q+1 |
| InChIKey | FGDRKLHOXQMVFB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.38 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|