C24H14F32O7S — CID 101241194
1,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecoxy)-1,4-dioxobutane-2-sulfonic acid (PubChem CID 101241194) has the molecular formula C24H14F32O7S and a molecular weight of 1054.37 g/mol. Its IUPAC name is 1,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecoxy)-1,4-dioxobutane-2-sulfonic acid.
| Compound Name | 1,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecoxy)-1,4-dioxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 101241194 |
| Molecular Formula | C24H14F32O7S |
| Molecular Weight | 1054.37 g/mol |
| Exact Mass | 1053.99 |
| IUPAC Name | 1,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecoxy)-1,4-dioxobutane-2-sulfonic acid |
| SMILES | O=C(CC(C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)S(=O)(=O)O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C24H14F32O7S/c25-9(26)13(33,34)17(41,42)21(49,50)23(53,54)19(45,46)15(37,38)11(29,30)1-3-62-7(57)5-6(64(59,60)61)8(58)63-4-2-12(31,32)16(39,40)20(47,48)24(55,56)22(51,52)18(43,44)14(35,36)10(27)28/h6,9-10H,1-5H2,(H,59,60,61) |
| InChIKey | BNBIIJUKGSUBEJ-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1054.37 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|