C22H12F30O7S — CID 101426369
1,4-bis[3,3,4,4,5,5,6,6,7,8,8,8-dodecafluoro-7-(trifluoromethyl)octoxy]-1,4-dioxobutane-2-sulfonic acid (PubChem CID 101426369) has the molecular formula C22H12F30O7S and a molecular weight of 990.34 g/mol. Its IUPAC name is 1,4-bis[3,3,4,4,5,5,6,6,7,8,8,8-dodecafluoro-7-(trifluoromethyl)octoxy]-1,4-dioxobutane-2-sulfonic acid.
| Compound Name | 1,4-bis[3,3,4,4,5,5,6,6,7,8,8,8-dodecafluoro-7-(trifluoromethyl)octoxy]-1,4-dioxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 101426369 |
| Molecular Formula | C22H12F30O7S |
| Molecular Weight | 990.34 g/mol |
| Exact Mass | 989.98 |
| IUPAC Name | 1,4-bis[3,3,4,4,5,5,6,6,7,8,8,8-dodecafluoro-7-(trifluoromethyl)octoxy]-1,4-dioxobutane-2-sulfonic acid |
| SMILES | O=C(CC(C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)S(=O)(=O)O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H12F30O7S/c23-9(24,13(29,30)17(37,38)15(33,34)11(27,19(41,42)43)20(44,45)46)1-3-58-7(53)5-6(60(55,56)57)8(54)59-4-2-10(25,26)14(31,32)18(39,40)16(35,36)12(28,21(47,48)49)22(50,51)52/h6H,1-5H2,(H,55,56,57) |
| InChIKey | PYWMCUKKOHNNSH-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.34 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|