C14H26O9S — CID 132606274
1,4-dioxo-1,4-bis(2-propan-2-yloxyethoxy)butane-2-sulfonic acid (PubChem CID 132606274) has the molecular formula C14H26O9S and a molecular weight of 370.42 g/mol. Its IUPAC name is 1,4-dioxo-1,4-bis(2-propan-2-yloxyethoxy)butane-2-sulfonic acid.
| Compound Name | 1,4-dioxo-1,4-bis(2-propan-2-yloxyethoxy)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 132606274 |
| Molecular Formula | C14H26O9S |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1,4-dioxo-1,4-bis(2-propan-2-yloxyethoxy)butane-2-sulfonic acid |
| SMILES | CC(C)OCCOC(=O)CC(C(=O)OCCOC(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C14H26O9S/c1-10(2)20-5-7-22-13(15)9-12(24(17,18)19)14(16)23-8-6-21-11(3)4/h10-12H,5-9H2,1-4H3,(H,17,18,19) |
| InChIKey | DNHYWLHOVUKIFX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|