C14H12F14O7S — CID 54539072
1,4-bis(3,3,4,4,5,5,5-heptafluoropentoxy)-1,4-dioxobutane-2-sulfonic acid (PubChem CID 54539072) has the molecular formula C14H12F14O7S and a molecular weight of 590.28 g/mol. Its IUPAC name is 1,4-bis(3,3,4,4,5,5,5-heptafluoropentoxy)-1,4-dioxobutane-2-sulfonic acid.
| Compound Name | 1,4-bis(3,3,4,4,5,5,5-heptafluoropentoxy)-1,4-dioxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 54539072 |
| Molecular Formula | C14H12F14O7S |
| Molecular Weight | 590.28 g/mol |
| Exact Mass | 590.01 |
| IUPAC Name | 1,4-bis(3,3,4,4,5,5,5-heptafluoropentoxy)-1,4-dioxobutane-2-sulfonic acid |
| SMILES | O=C(CC(C(=O)OCCC(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)O)OCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F14O7S/c15-9(16,11(19,20)13(23,24)25)1-3-34-7(29)5-6(36(31,32)33)8(30)35-4-2-10(17,18)12(21,22)14(26,27)28/h6H,1-5H2,(H,31,32,33) |
| InChIKey | ZBVUORCMLITFRC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|