C16H24F7NaO7S — CID 173139828
sodium;1-(2-ethylhexoxy)-4-(2,2,3,3,4,4,4-heptafluorobutoxy)-1,4-dioxobutane-2-sulfonic acid;hydride (PubChem CID 173139828) has the molecular formula C16H24F7NaO7S and a molecular weight of 516.40 g/mol. Its IUPAC name is sodium;1-(2-ethylhexoxy)-4-(2,2,3,3,4,4,4-heptafluorobutoxy)-1,4-dioxobutane-2-sulfonic acid;hydride.
| Compound Name | sodium;1-(2-ethylhexoxy)-4-(2,2,3,3,4,4,4-heptafluorobutoxy)-1,4-dioxobutane-2-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173139828 |
| Molecular Formula | C16H24F7NaO7S |
| Molecular Weight | 516.40 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | sodium;1-(2-ethylhexoxy)-4-(2,2,3,3,4,4,4-heptafluorobutoxy)-1,4-dioxobutane-2-sulfonic acid;hydride |
| SMILES | CCCCC(CC)COC(=O)C(CC(=O)OCC(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C16H23F7O7S.Na.H/c1-3-5-6-10(4-2)8-29-13(25)11(31(26,27)28)7-12(24)30-9-14(17,18)15(19,20)16(21,22)23;;/h10-11H,3-9H2,1-2H3,(H,26,27,28);;/q;+1;-1 |
| InChIKey | ZQYLKOTUOPILAT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|