C19H35NaO7S — CID 58711088
sodium 4-(2-ethylhexoxy)-1-(2-ethylpentoxy)-1,4-dioxobutane-2-sulfonate (PubChem CID 58711088) has the molecular formula C19H35NaO7S and a molecular weight of 430.54 g/mol. Its IUPAC name is sodium 4-(2-ethylhexoxy)-1-(2-ethylpentoxy)-1,4-dioxobutane-2-sulfonate.
| Compound Name | sodium 4-(2-ethylhexoxy)-1-(2-ethylpentoxy)-1,4-dioxobutane-2-sulfonate |
|---|---|
| PubChem CID | 58711088 |
| Molecular Formula | C19H35NaO7S |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | sodium 4-(2-ethylhexoxy)-1-(2-ethylpentoxy)-1,4-dioxobutane-2-sulfonate |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCC)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C19H36O7S.Na/c1-5-9-11-16(8-4)13-25-18(20)12-17(27(22,23)24)19(21)26-14-15(7-3)10-6-2;/h15-17H,5-14H2,1-4H3,(H,22,23,24);/q;+1/p-1 |
| InChIKey | BBZJDPBILAMDMK-UHFFFAOYSA-M |
| XLogP | 0.42 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|