C20H41NO7S — CID 3015509
azanium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate (PubChem CID 3015509) has the molecular formula C20H41NO7S and a molecular weight of 439.62 g/mol. Its IUPAC name is azanium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate.
| Compound Name | azanium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate |
|---|---|
| PubChem CID | 3015509 |
| Molecular Formula | C20H41NO7S |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | azanium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/C20H38O7S.H3N/c1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;/h16-18H,5-15H2,1-4H3,(H,23,24,25);1H3 |
| InChIKey | BWSNWGNFRMLBCY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|